Ab Index-Nr. 015-029-00-4

Index-Nr.Internationale chemische BezeichnungEG-Nr.CAS-Nr.EinstufungKennzeichnungbis 30.11.2018: Spezifische Konzentrations-
grenzen,
M-Faktoren
ab 01.12.2018: Spezifische Konzentrations-
grenzen
M-Faktoren und ATE
Anmer-
kungen
Gefahrenklasse, Gefahren-
kategorie und Gefahren-
kodierung
Kodierung der Gefahrenhin-
weise
Piktogramm, Kodierung der SignalworteKodierung der Gefahrenhin-
weise
Kodierung der ergänzenden Gefahren-
merkmale
015-029-00-4demeton-S (ISO);
diethyl-S-2-ethylthioethyl phosphorothioate
204-801-8126-75-0Acute Tox. 1
Acute Tox. 2 *
H310
H300
GHS06
Dgr
H310
H300
   
015-030-00-Xdemeton-O-methyl (ISO);
O-2-ethylthioethyl O,O-dimethyl phosphorothioate
212-758-1867-27-6Acute Tox. 3 *H301GHS06
Dgr
H301   
015-031-00-5demeton-S-methyl (ISO);
S-2-ethylthioethyl dimethyl phosphorothioate
213-052-6919-86-8Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Chronic 2
H311
H301
H411
GHS06
GHS09
Dgr
H311
H301
H411
   
015-032-00-0prothoate (ISO);
O,O-diethyl isopropylcarbamoylmethyl
phosphorodithioate
218-893-22275-18-5Acute Tox. 1
Acute Tox. 2 *
Aquatic Chronic 3
H310
H300
H412
GHS06
Dgr
H310
H300
H412
   
015-033-00-6phorate (ISO);
O,O-diethyl ethylthiomethyl phosphorodithioate
206-052-2298-02-2Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
 M = 1000 
015-034-00-1parathion (ISO);
O,O-diethyl O-4-nitrophenyl phosphorothioate
200-271-756-38-2Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
STOT RE 1
Aquatic Acute 1
Aquatic Chronic 1
H330
H300
H311
H372 **
H400
H410
GHS06
GHS08
GHS09
Dgr
H330
H300
H311
H372 **
H410
 M = 100 
015-035-00-7parathion – methyl (ISO);
O,O-dimethyl O-4-nitrophenyl phosphorothioate
206-050-1298-00-0Flam. Liq. 3
Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
STOT RE 2 *
Aquatic Acute 1
Aquatic Chronic 1
H226
H330
H300
H311
H373 **
H400
H410
GHS02
GHS06
GHS08
GHS09
Dgr
H226
H330
H300
H311
H373 **
H410
 M = 100 
015-036-00-2O-ethyl O-4-nitrophenyl phenylphosphonothioate;
EPN
218-276-82104-64-5Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
   
015-037-00-8phenkapton (ISO);
S-(2,5-dichlorophenylthiomethyl) O,O-die-
thyl phosphorodithioate
218-892-72275-14-1Acute Tox. 3 *
Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H331
H311
H301
H400
H410
GHS06
GHS09
Dgr
H331
H311
H301
H410
   
015-038-00-3coumaphos (ISO);
O-3-chloro-4-methylcoumarin-7-yl O,O-
diethyl phosphorothioate
200-285-356-72-4Acute Tox. 2 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H312
H400
H410
GHS06
GHS09
Dgr
H300
H312
H410
   
015-039-00-9azinphos-methyl (ISO);
O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate
201-676-186-50-0Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H330
H300
H311
H317
H400
H410
GHS06
GHS09
Dgr
H330
H300
H311
H317
H410
   
015-040-00-4diazinon (ISO);
O,O-diethyl O-2-isopropyl-6-methylpyrimi-
din-4-yl phosphorothioate
206-373-8333-41-5Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H302
H400
H410
GHS07
GHS09
Wng
H302
H400
H410
   
015-041-00-Xmalathion (ISO);
1,2-bis(ethoxycarbonyl)ethyl O,O-dimethyl
phosphorodithioate;
[containing ≤ 0,03 % isomalathion]
204-497-7121-75-5Acute Tox. 4 *
Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H302
H317
H400
H410
GHS07
GHS09
Wng
H302
H317
H410
 M = 1000 
015-042-00-5chlorthion
O-(3-chloro-4-nitrophenyl) O,O-dimethyl
phosphorothioate
207-902-5500-28-7Acute Tox. 4 *
Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H332
H312
H302
H400
H410
GHS07
GHS09
Wng
H332
H312
H302
H410
 M = 100 
015-043-00-0phosnichlor (ISO);
O-4-chloro-3-nitrophenyl O,O-dimethyl
phosphorothioate
5826-76-6Acute Tox. 4 *
Acute Tox. 4 *
Acute Tox. 4 *
H332
H312
H302
GHS07
Wng
H332
H312
H302
   
015-044-00-6carbophenothion (ISO);
4-chlorophenylthiomethyl O,O-diethyl
phosphorodithioate
212-324-1786-19-6Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H311
H301
H400
H410
GHS06
GHS09
Dgr
H311
H301
H410
   
015-045-00-1mecarbam (ISO);
N-ethoxycarbonyl-N-methylcarbamoylme-
thyl O,O-diethyl phosphorodithioate
219-993-92595-54-2Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H311
H301
H400
H410
GHS06
GHS09
Dgr
H311
H301
H400
H410
   
015-046-00-7oxydemeton-methyl;
S-2-(ethylsulphinyl)ethyl O,O-dimethyl
phosphorothioate
206-110-7301-12-2Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
H311
H301
H400
GHS06
GHS09
Dgr
H311
H301
H400
   
015-047-00-2ethion (ISO);
O,O,O',O'-tetraethyl S,S'-methylenedi (phos-
phorodithioate);
diethion
209-242-3563-12-2Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H301
H312
H400
H410
GHS06
GHS09
Dgr
H301
H312
H410
 M = 10000 
015-048-00-8fenthion (ISO);
O,O-dimethyl-O-(4-methylthion-m-tolyl)
phosphorothioate
200-231-955-38-9Muta. 2
Acute Tox. 3 *
Acute Tox. 4 *
Acute Tox. 4 *
STOT RE 1
Aquatic Acute 1
Aquatic Chronic 1
H341
H331
H312
H302
H372 **
H400
H410
GHS06
GHS08
GHS09
Dgr
H341
H331
H312
H302
H372 **
H410
 M = 100 
015-049-00-3endothion (ISO);
S-5-methoxy-4-oxopyran-2-ylmethyl dime-
thyl phosphorothioate
220-472-32778-04-3Acute Tox. 3 *
Acute Tox. 3 *
H311
H301
GHS06
Dgr
H311
H301
   
015-050-00-9thiometon (ISO);
S-2-ethylthioethyl O,O-dimethyl phospho-
rodithioate
211-362-6640-15-3Acute Tox. 3 *
Acute Tox. 4 *
H301
H312
GHS06
Dgr
H301
H312
   
015-051-00-4dimethoate (ISO);
O,O-dimethyl methylcarbamoylmethyl
phosphorodithioate
200-480-360-51-5Acute Tox. 4 *
Acute Tox. 4 *
H312
H302
GHS07
Wng
H312
H302
   
015-052-00-Xfenchlorphos (ISO);
O,O-dimethyl O–2,4,5-trichlorophenyl
phosphorothioate
206-082-6299-84-3Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
   
015-053-00-5menazon (ISO);
S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]
O, O-dimethyl phosphorodithioate
201-123-478-57-9Acute Tox. 4 *
Aquatic Chronic 3
H302
H412
GHS07
Wng
H302
H412
   
015-054-00-0fenitrothion (ISO);
O,O-dimethyl O-4-nitro-m-tolyl phospho-
rothioate
204-524-2122-14-5Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H302
H400
H410
GHS07
GHS09
Wng
H302
H410
   
015-055-00-6naled (ISO);
1,2-dibromo-2,2-dichloroethyl dimethyl
phosphate
206-098-3300-76-5Acute Tox. 4 *
Acute Tox. 4 *
Eye Irrit. 2
Skin Irrit. 2
Aquatic Acute 1
H312
H302
H319
H315
H400
GHS07
GHS09
Wng
H312
H302
H319
H315
H400
 M = 1000 
015-056-00-1azinphos-ethyl (ISO);
O,O-diethyl 4-oxobenzotriazin-3-ylmethyl
phosphorodithioate
220-147-62642-71-9Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
 M = 100 
015-057-00-7formothion (ISO);
N-formyl-N-methylcarbamoylmethyl O,O-
dimethyl phosphorodithioate
219-818-62540-82-1Acute Tox. 4 *
Acute Tox. 4 *
H312
H302
GHS07
Wng
H312
H302
   
015-058-00-2morphothion (ISO);
O,O-dimethyl-S-(morpholinocarbonylme-
thyl) phosphorodithioate
205-628-0144-41-2Acute Tox. 3 *
Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H331
H311
H301
H400
H410
GHS06
GHS09
Dgr
H331
H311
H301
H410
   
015-059-00-8vamidothion (ISO);
O,O-dimethyl S-2-(1-methylcarbamoyle-
thylthio) ethyl phosphorothioate
218-894-82275-23-2Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Acute 1
H301
H312
H400
GHS06
GHS09
Dgr
H301
H312
H400
   
015-060-00-3disulfoton (ISO);
O,O-diethyl 2-ethylthioethyl phosphorodi-
thioate
206-054-3298-04-4Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
   
015-061-00-9dimefox (ISO);
tetramethylphosphorodiamidic fluoride
204-076-8115-26-4Acute Tox. 1
Acute Tox. 2 *
H310
H300
GHS06
Dgr
H310
H300
   
015-062-00-4mipafox (ISO);
N,N'- di-isopropylphosphorodiamidic fluo-
ride
206-742-3371-86-8STOT SE 1H370 **GHS08
Dgr
H370 **   
015-063-00-Xdioxathion (ISO);
1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di
(phosphorodithioate)
201-107-778-34-2Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H330
H300
H311
H400
H410
GHS06
GHS09
Dgr
H330
H300
H311
H410
 M = 1000 
015-064-00-5bromophos-ethyl (ISO);
O-4-bromo-2,5-dichlorophenyl O,O-diethyl
phosphorothioate
225-399-04824-78-6Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H301
H312
H400
H410
GHS06
GHS09
Dgr
H301
H312
H410
   
015-065-00-0S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl
phosphorodithioate
2703-37-9Acute Tox. 2 *
Acute Tox. 1
Acute Tox. 2 *
Aquatic Chronic 2
H330
H310
H300
H411
GHS06
GHS09
Dgr
H330
H310
H300
H411
   
015-066-00-6omethoate (ISO);
O,O-dimethyl S-methylcarbamoylmethyl
phosphorothioate
214-197-81113-02-6Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Acute 1
H301
H312
H400
GHS06
GHS09
Dgr
H301
H312
H400
   
015-067-00-1phosalone (ISO);
S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl)
O,O-diethyl phosphorodithioate
218-996-22310-17-0Acute Tox. 3 *
Acute Tox. 4 *
Acute Tox. 4 *
Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H301
H332
H312
H317
H400
H410
GHS06
GHS09
Dgr
H301
H332
H312
H317
H410
 M = 1000 
015-068-00-7dichlofenthion (ISO);
O–2,4-dichlorophenyl O,O-diethyl phos-
phorothioate
202-564-597-17-6Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H302
H400
H410
GHS07
GHS09
Wng
H302
H400
H410
   
015-069-00-2methidathion (ISO);
2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadia-
zol-3-ylmethyl-O,O-dimethylphosphorodi-
thioate
213-449-4950-37-8Acute Tox. 2 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H312
H400
H410
GHS06
GHS09
Dgr
H300
H312
H410
   
015-070-00-8cyanthoate (ISO);
S-(N-(1-cyano-1-methylethyl)carbamoylme-
thyl) O,O-diethyl phosphorothioate
223-099-43734-95-0Acute Tox. 2 *
Acute Tox. 3 *
H300
H311
GHS06
Dgr
H300
H311
   
015-071-00-3chlorfenvinphos (ISO);
2-chloro-1-(2,4 dichlorophenyl) vinyl die-
thyl phosphate
207-432-0470-90-6Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
   
015-072-00-9monocrotophos (ISO);
dimethyl-1-methyl-2-(methylcarbamoyl)
vinyl phosphate
230-042-76923-22-4Muta. 2
Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H341
H330
H300
H311
H400
H410
GHS06
GHS08
GHS09
Dgr
H341
H330
H300
H311
H410
   
015-073-00-4dicrotophos (ISO);
(Z)-2-dimethylcarbamoyl-1-methylvinyl
dimethyl phosphate
205-494-3141-66-2Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
   
015-074-00-Xcrufomate (ISO);
4-tert-butyl-2-chlorophenyl methyl methyl-
phosphoramidate
206-083-1299-86-5Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
   
015-075-00-5S-[2-(isopropylsulphinyl)ethyl] O,O-dime-
thyl phosphorothioate
2635-50-9Acute Tox. 3 *
Acute Tox. 3 *
Acute Tox. 3 *
H331
H311
H301
GHS06
Dgr
H331
H311
H301
   
015-076-00-0potasan;
O, O-diethyl O-(4-methylcoumarin-7-yl)
phosphorothioate
299-45-6Acute Tox. 2 *
Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H330
H310
H300
H400
H410
GHS06
GHS09
Dgr
H330
H310
H300
H410
 M = 1000 
015-077-00-62,2-dichlorovinyl 2-ethylsulphinylethyl
methyl phosphate
7076-53-1Acute Tox. 3 *
Acute Tox. 3 *
Acute Tox. 3 *
H331
H311
H301
GHS06
Dgr
H331
H311
H301
   
015-078-00-1demeton-S-methylsulphon (ISO);
S-2-ethylsulphonylethyl dimethyl phospho-
rothioate
241-109-517040-19-6Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Chronic 2
H301
H312
H411
GHS06
GHS09
Dgr
H301
H312
H411
   
015-079-00-7acephate (ISO);
O,S-dimethyl acetylphosphoramidothioate
250-241-230560-19-1Acute Tox. 4 *H302GHS07
Wng
H302   
015-080-00-2amidithion (ISO);
2-methoxyethylcarbamoylmethyl O,O-
dimethyl phosphorodithioate
919-76-6Acute Tox. 4 *H302GHS07
Wng
H302   
015-081-00-8O,O,O',O'-tetrapropyl dithiopyrophosphate221-817-03244-90-4Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
   
015-082-00-3azothoate (ISO);
O-4-(4-chlorophenylazo)phenyl O,O-dime-
thyl phosphorothioate
227-419-35834-96-8Acute Tox. 4 *
Acute Tox. 4 *
H332
H302
GHS07
Wng
H332
H302
   
015-083-00-9bensulide (ISO);
O,O-diisopropyl 2-phenylsulphonylaminoe-
thyl phosphorodithioate
212-010-4741-58-2Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H302
H400
H410
GHS07
GHS09
Wng
H302
H410
   
015-084-00-4chlorpyrifos (ISO);
O,O-diethyl O–3,5,6-trichloro-2-pyridyl
phosphorothioate
220-864-42921-88-2Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H301
H400
H410
GHS06
GHS09
Dgr
H301
H400
H410
 M = 10000 
015-085-00-Xchlorphonium chloride (ISO);
tributyl (2,4-dichlorobenzyl) phosphonium
chloride
204-105-4115-78-6Acute Tox. 3 *
Acute Tox. 4 *
Eye Irrit. 2
Skin Irrit. 2
H301
H312
H319
H315
GHS06
Dgr
H301
H312
H319
H315
   
015-086-00-5coumithoate (ISO);
O,O-diethyl O–7,8,9,10-tetrahydro-6-oxo-
benzo(c)chromen-3-yl phosphorothioate
572-48-5Acute Tox. 3 *H301GHS06
Dgr
H301   
015-087-00-0cyanophos (ISO);
O-4-cyanophenyl O,O-dimethyl phospho-
rothioate
220-130-32636-26-2Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
   
015-088-00-6dialifos (ISO);
2-chloro-1-phthalimidoethyl O,O-diethyl
phosphorodithioate
233-689-310311-84-9Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H400
H410
   
015-089-00-1ethoate-methyl (ISO);
ethylcarbamoylmethyl O,O-dimethyl phos-
phorodithioate
204-121-1116-01-8Acute Tox. 4 *
Acute Tox. 4 *
H312
H302
GHS07
Wng
H312
H302
   
015-090-00-7fensulfothion (ISO);
O,O-diethyl O-4-methylsulfinylphenyl
phosphorothioate
204-114-3115-90-2Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
   
015-091-00-2fonofos (ISO);
O-ethyl phenyl ethylphosphonodithioate
213-408-0944-22-9Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
   
015-092-00-8phosacetim (ISO);
O,O-bis(4-chlorophenyl) N-acetimidoylpho-
sphoramidothioate
223-874-74104-14-7Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
   
015-093-00-3leptophos (ISO);
O-4-bromo-2,5-dichlorophenyl O-methyl
phenylphosphorothioate
244-472-821609-90-5Acute Tox. 3 *
STOT SE 1
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H301
H370 **
H312
H400
H410
GHS06
GHS08
GHS09
Dgr
H301
H370 **
H312
H410
   
015-094-00-9mephosfolan (ISO);
diethyl 4-methyl-1,3-dithiolan-2-ylidene-
phosphoramidate
213-447-3950-10-7Acute Tox. 1
Acute Tox. 2 *
Aquatic Chronic 2
H310
H300
H411
GHS06
GHS09
Dgr
H310
H300
H411
   
015-095-00-4methamidophos (ISO);
O,S-dimethyl phosphoramidothioate
233-606-010265-92-6Acute Tox. 2 *
Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
H330
H300
H311
H400
GHS06
GHS09
Dgr
H330
H300
H311
H400
   
015-096-00-Xoxydisulfoton (ISO);
O, O-diethyl S-2-ethylsulphinylethyl phos-
phorodithioate
219-679-12497-07-6Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
 M = 10 
015-097-00-5phenthoate (ISO);
ethyl 2-(dimethoxyphosphinothioylthio)-2-
phenylacetate
219-997-02597-03-7Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
 M = 100 
015-098-00-0trichloronate (ISO);
O-ethyl O–2,4,5-trichlorophenyl ethylpho-
sphonothioate
206-326-1327-98-0Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
   
015-099-00-6pirimiphos-ethyl (ISO);
O,O-diethyl O-2-diethylamino-6-methylpy-
rimidin-4-yl phosphorothioate
245-704-023505-41-1Acute Tox. 3 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H301
H312
H400
H410
GHS06
GHS09
Dgr
H301
H312
H410
   
015-100-00-Xphoxim (ISO);
α-(diethoxyphosphinothioylimino) phenylace-
tonitrile
238-887-314816-18-3Repr. 2
Acute Tox. 4 *
Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H361f ***
H302
H317
H400
H410
GHS08
GHS07
GHS09
Wng
H361f ***
H302
H317
H410
 M = 1000 
015-101-00-5phosmet (ISO);
O,O-dimethyl phthalimidomethyl S-phos-
phorodithioate
211-987-4732-11-6Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H312
H302
H400
H410
GHS07
GHS09
Wng
H312
H302
H410
 M = 100 
015-102-00-0tris(2-chloroethyl)phosphate204-118-5115-96-8Carc. 2
Repr. 1B
Acute Tox. 4 *
Aquatic Chronic 2
H351
H360F ***
H302
H411
GHS08
GHS07
GHS09
Dgr
H351
H360F ***
H302
H411
   
015-103-00-6phosphorus tribromide232-178-27789-60-8Skin Corr. 1B
STOT SE 3
H314
H335
GHS05
GHS07
Dgr
H314
H335
EUH014  
015-104-00-1diphosphorus pentasulphide;
phosphorus pentasulphide
215-242-41314-80-3Flam. Sol. 1
Water-react. 1
Acute Tox. 4 *
Acute Tox. 4 *
Aquatic Acute 1
H228
H260
H332
H302
H400
GHS02
GHS07
GHS09
Dgr
H228
H260
H332
H302
H400
EUH029 T
015-105-00-7triphenyl phosphite202-908-4101-02-0Eye Irrit. 2
Skin Irrit. 2
Aquatic Acute 1
Aquatic Chronic 1
H319
H315
H400
H410
GHS07
GHS09
Wng
H319
H315
H410
 Skin Irrit. 2;
H315: C ≥ 5 %
Eye Irrit. 2; H319: C ≥ 5 %
 
015-106-00-2hexamethylphosphoric triamide;
hexamethylphosphoramide
211-653-8680-31-9Carc. 1B
Muta. 1B
H350
H340
GHS08
Dgr
H350
H340
 Carc. 1B; H350: C
≥ 0.01 %
 
015-107-00-8ethoprophos (ISO);
ethyl-S,S-dipropyl phosphorodithioate
236-152-113194-48-4Acute Tox. 2 *
Acute Tox. 1
Acute Tox. 3 *
Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H330
H310
H301
H317
H400
H410
GHS06
GHS09
Dgr
H330
H310
H301
H317
H410
   
015-108-00-3bromophos (ISO);
O-4-bromo-2,5-dichlorophenyl O,O-dime-
thyl phosphorothioate
218-277-32104-96-3Acute Tox. 4 *
Aquatic Acute 1
Aquatic Chronic 1
H302
H400
H410
GHS07
GHS09
Wng
H302
H410
 M = 100 
015-109-00-9crotoxyphos (ISO);
1-phenylethyl 3-(dimethoxyphosphinyloxy)
isocrotonate
231-720-57700-17-6Acute Tox. 3 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H311
H301
H400
H410
GHS06
GHS09
Dgr
H311
H301
H410
 M = 10 
015-110-00-4cyanofenphos (ISO);
O-4-cyanophenyl O-ethyl phenylphospho-
nothioate
13067-93-1Acute Tox. 3 *
STOT SE 1
Acute Tox. 4 *
Eye Irrit. 2
Aquatic Chronic 2
H301
H370 **
H312
H319
H411
GHS06
GHS08
GHS09
Dgr
H301
H370 **
H312
H319
H411
   
015-111-00-Xphosfolan (ISO);
diethyl 1,3-dithiolan-2-ylidenephosphora-
midate
213-423-2947-02-4Acute Tox. 1
Acute Tox. 2 *
H310
H300
GHS06
Dgr
H310
H300
   
015-112-00-5thionazin (ISO);
O,O-diethyl O-pyrazin-2-yl phosphoro-
thioate;
206-049-6297-97-2Acute Tox. 1
Acute Tox. 2 *
H310
H300
GHS06
Dgr
H310
H300
   
015-113-00-0tolclofos-methyl (ISO);
O-(2,6-dichloro-p-tolyl)-O,O-
dimethyl thiophosphate
260-515-357018-04-9Skin Sens. 1
Aquatic Acute 1
Aquatic Chronic 1
H317
H400
H410
GHS07
GHS09
Wng
H317
H410
   
015-114-00-6chlormephos (ISO);
S-chloromethyl O,O-diethyl phosphorodithioate
246-538-124934-91-6Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
Aquatic Chronic 1
H310
H300
H400
H410
GHS06
GHS09
Dgr
H310
H300
H410
 M = 10 
015-115-00-1chlorthiophos (ISO);
[isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate predominates]
244-663-621923-23-9Acute Tox. 2 *
Acute Tox. 3 *
Aquatic Acute 1
Aquatic Chronic 1
H300
H311
H400
H410
GHS06
GHS09
Dgr
H300
H311
H410
 M = 1000 
015-116-00-7demephion-O (ISO);
O,O-dimethyl O-2-methylthioethyl phos-
phorothioate
211-666-9682-80-4Acute Tox. 2 *
Acute Tox. 3 *
H300
H311
GHS06
Dgr
H300
H311
   
015-117-00-2demephion-S (ISO);
O,O-dimethyl S-2-methylthioethyl phos-
phorothioate
219-971-92587-90-8Acute Tox. 2 *
Acute Tox. 3 *
H300
H311
GHS06
Dgr
H300
H311
   
015-118-00-8demeton8065-48-3Acute Tox. 1
Acute Tox. 2 *
Aquatic Acute 1
H310
H300
H400
GHS06
GHS09
Dgr
H310
H300
H400
   
015-119-00-3dimethyl 4-(methylthio)phenyl phosphate3254-63-5Acute Tox. 1
Acute Tox. 2 *
H310
H300
GHS06
Dgr
H310
H300
   
015-120-00-9ditalimfos (ISO);
O,O-diethyl phthalimidophosphonothioate
225-875-85131-24-8Skin Irrit. 2
Skin Sens. 1
H315
H317
GHS07
Wng
H315
H317